* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-HYDROXY-1H-INDAZOL-6-OL |
| CAS: | 877472-47-4 |
| English Synonyms: | 1H-INDAZOL-6-OL, 1-HYDROXY- ; 1-HYDROXY-1H-INDAZOL-6-OL |
| MDL Number.: | MFCD16878900 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc2cnn(c2cc1O)O |
| InChi: | InChI=1S/C7H6N2O2/c10-6-2-1-5-4-8-9(11)7(5)3-6/h1-4,10-11H |
| InChiKey: | InChIKey=SRWTZNZVRJVIGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.