* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YM-231146 |
| CAS: | 877614-59-0 |
| English Synonyms: | YM-231146 |
| MDL Number.: | MFCD11040916 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)/C(=C/3\C=Cc4cc(ccc4N3)OCCN5CCOCC5)/C(=O)N2 |
| InChi: | InChI=1S/C23H23N3O3/c27-23-22(18-3-1-2-4-20(18)25-23)21-7-5-16-15-17(6-8-19(16)24-21)29-14-11-26-9-12-28-13-10-26/h1-8,15,24H,9-14H2,(H,25,27)/b22-21- |
| InChiKey: | InChIKey=FZYSGKHNSWAESJ-DQRAZIAOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.