* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-IODO-2-PHENYL-PYRANO[2,3-B]PYRIDIN-4-ONE |
| CAS: | 878199-44-1 |
| English Synonyms: | 3-IODO-2-PHENYL-PYRANO[2,3-B]PYRIDIN-4-ONE |
| MDL Number.: | MFCD08752412 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2c(c(=O)c3cccnc3o2)I |
| InChi: | InChI=1S/C14H8INO2/c15-11-12(17)10-7-4-8-16-14(10)18-13(11)9-5-2-1-3-6-9/h1-8H |
| InChiKey: | InChIKey=IYVSMLQCTORVJO-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.