* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[5,4-E]PYRAZOLO[5,1-C][1,2,4]TRIAZINE |
| CAS: | 87986-56-9 |
| English Synonyms: | ISOXAZOLO[5,4-E]PYRAZOLO[5,1-C][1,2,4]TRIAZINE |
| MDL Number.: | MFCD16294684 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1cnn2c1nnc3c2onc3 |
| InChi: | InChI=1S/C6H3N5O/c1-2-7-11-5(1)10-9-4-3-8-12-6(4)11/h1-3H |
| InChiKey: | InChIKey=SJQMSKIXPHFHIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.