* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PURINE-2,6,8(3H)-TRIONE, 7,9-DIHYDRO-, HYDRATE (1:1) |
CAS: | 880347-59-1 |
English Synonyms: | 1H-PURINE-2,6,8(3H)-TRIONE, 7,9-DIHYDRO-, HYDRATE (1:1) |
MDL Number.: | MFCD17018482 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | O.N1C(NC=2NC(NC2C1=O)=O)=O |
InChi: | InChI=1S/C5H4N4O3.H2O/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;/h(H4,6,7,8,9,10,11,12);1H2 |
InChiKey: | InChIKey=KTWFZIRYVDSYGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.