* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(3,6-DIHYDRO-2H-PYRAN-4-YL)-1H-INDAZOLE |
| CAS: | 885271-92-1 |
| English Synonyms: | 6-(3,6-DIHYDRO-2H-PYRAN-4-YL)-1H-INDAZOLE |
| MDL Number.: | MFCD04114658 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2cn[nH]c2cc1C3=CCOCC3 |
| InChi: | InChI=1S/C12H12N2O/c1-2-11-8-13-14-12(11)7-10(1)9-3-5-15-6-4-9/h1-3,7-8H,4-6H2,(H,13,14) |
| InChiKey: | InChIKey=WWEHRQSPKGIGLU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.