* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FURAN-2-YL-1H-INDAZOLE |
| CAS: | 885271-95-4 |
| English Synonyms: | 6-FURAN-2-YL-1H-INDAZOLE |
| MDL Number.: | MFCD04114660 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(oc1)c2ccc3cn[nH]c3c2 |
| InChi: | InChI=1S/C11H8N2O/c1-2-11(14-5-1)8-3-4-9-7-12-13-10(9)6-8/h1-7H,(H,12,13) |
| InChiKey: | InChIKey=DYIYVKCOAHSLAN-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.