* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-FURAN-3-YL-1H-INDAZOLE |
| CAS: | 885271-98-7 |
| English Synonyms: | 6-FURAN-3-YL-1H-INDAZOLE |
| MDL Number.: | MFCD04114661 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2cn[nH]c2cc1c3ccoc3 |
| InChi: | InChI=1S/C11H8N2O/c1-2-9-6-12-13-11(9)5-8(1)10-3-4-14-7-10/h1-7H,(H,12,13) |
| InChiKey: | InChIKey=MWAVNERLYUXBFE-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.