* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [2-(3-ETHYL-PHENYL)-OXAZOL-4-YL]-METHANOL |
CAS: | 885272-71-9 |
English Synonyms: | [2-(3-ETHYL-PHENYL)-OXAZOL-4-YL]-METHANOL |
MDL Number.: | MFCD06738573 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1cccc(c1)c2nc(co2)CO |
InChi: | InChI=1S/C12H13NO2/c1-2-9-4-3-5-10(6-9)12-13-11(7-14)8-15-12/h3-6,8,14H,2,7H2,1H3 |
InChiKey: | InChIKey=DTPLNUJUGVKXNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.