* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(5-METHYL-THIOPHEN-2-YL)-1H-INDAZOLE |
CAS: | 885272-88-8 |
English Synonyms: | 5-(5-METHYL-THIOPHEN-2-YL)-1H-INDAZOLE |
MDL Number.: | MFCD05663976 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccc(s1)c2ccc3c(c2)cn[nH]3 |
InChi: | InChI=1S/C12H10N2S/c1-8-2-5-12(15-8)9-3-4-11-10(6-9)7-13-14-11/h2-7H,1H3,(H,13,14) |
InChiKey: | InChIKey=CBKCXAJFGJLDKP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.