Molecular Structure:
CAS No.:
885518-25-2
Product Name.:
CCD No.:CCD00577863
Formula:C8 H7 F N2
MolWeight:150.155
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(11)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 4-AMINO-6-FLUOROINDOLE |
| CAS： | 885518-25-2 |
| English Synonyms： | 4-AMINO-6-FLUOROINDOLE ; ABLOCK AB-12-2827 ; 6-FLUORO-1H-INDOL-4-AMINE |
| MDL Number.： | MFCD07357294 |
| H bond acceptor： | 2 |
| H bond donor： | 2 |
| Smile： | c1c[nH]c2c1c(cc(c2)F)N |
| InChi： | InChI=1S/C8H7FN2/c9-5-3-7(10)6-1-2-11-8(6)4-5/h1-4,11H,10H2 |
| InChiKey： | InChIKey=XSFWKDMLYWEBHG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
