* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PI-540 |
| CAS: | 885616-78-4 |
| English Synonyms: | PI-540 |
| MDL Number.: | MFCD12922522 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CN1CCN(CC1)Cc2cc3c(s2)c(nc(n3)c4cccc(c4)O)N5CCOCC5 |
| InChi: | InChI=1S/C22H27N5O2S/c1-25-5-7-26(8-6-25)15-18-14-19-20(30-18)22(27-9-11-29-12-10-27)24-21(23-19)16-3-2-4-17(28)13-16/h2-4,13-14,28H,5-12,15H2,1H3 |
| InChiKey: | InChIKey=OKWPNODGKOTLAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.