* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1,8-NAPHTHYRIDIN-2-YL)ETHANOL |
CAS: | 886362-87-4 |
English Synonyms: | ABBYPHARMA AP-11-10361 ; 2-(1,8-NAPHTHYRIDIN-2-YL)ETHANOL ; 2-(1,8-NAPHTHYRIDIN-2-YL)ETHAN-1-OL |
MDL Number.: | MFCD06738468 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2ccc(nc2nc1)CCO |
InChi: | InChI=1S/C10H10N2O/c13-7-5-9-4-3-8-2-1-6-11-10(8)12-9/h1-4,6,13H,5,7H2 |
InChiKey: | InChIKey=VUBXIPMQFDHNTL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.