* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3',4,4',6-PENTABROMO-3,5-DIFLUORODIPHENYL ETHER |
| CAS: | 886748-35-2 |
| English Synonyms: | 2,3',4,4',6-PENTABROMO-3,5-DIFLUORODIPHENYL ETHER ; 3,5-DIFLUORO-2,3',4,4',6-PENTABROMODIPHENYL ETHER ; 2F-PBDE-119 |
| MDL Number.: | MFCD09037670 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc(c(cc1Oc2c(c(c(c(c2Br)F)Br)F)Br)Br)Br |
| InChi: | InChI=1S/C12H3Br5F2O/c13-5-2-1-4(3-6(5)14)20-12-8(16)10(18)7(15)11(19)9(12)17/h1-3H |
| InChiKey: | InChIKey=UFOYTVSJLKWAMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.