* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-PROPYN-1-YL)-1(3H)-ISOBENZOFURANONE |
| CAS: | 886993-40-4 |
| English Synonyms: | 3-(2-PROPYN-1-YL)-1(3H)-ISOBENZOFURANONE ; 3-(PROP-2-YN-1-YL)-1,3-DIHYDRO-2-BENZOFURAN-1-ONE |
| MDL Number.: | MFCD15146130 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C#CCC1c2ccccc2C(=O)O1 |
| InChi: | InChI=1S/C11H8O2/c1-2-5-10-8-6-3-4-7-9(8)11(12)13-10/h1,3-4,6-7,10H,5H2 |
| InChiKey: | InChIKey=ZVOJQMWJSKKMTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.