* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-DIHYDRO-1H-PYRIDO[3,4-B]AZEPINE-2,5-DIONE |
CAS: | 887576-77-4 |
English Synonyms: | 1H,2H,3H,4H,5H-PYRIDO[3,4-B]AZEPINE-2,5-DIONE ; 3,4-DIHYDRO-1H-PYRIDO[3,4-B]AZEPINE-2,5-DIONE |
MDL Number.: | MFCD06656947 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cncc2c1C(=O)CCC(=O)N2 |
InChi: | InChI=1S/C9H8N2O2/c12-8-1-2-9(13)11-7-5-10-4-3-6(7)8/h3-5H,1-2H2,(H,11,13) |
InChiKey: | InChIKey=AIXRBNUZJXAHEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.