* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRROLO[2,1-C][1,4]BENZOXAZIN-7-AMINE, 2,3,3A,4-TETRAHYDRO- |
CAS: | 887591-14-2 |
English Synonyms: | 1H-PYRROLO[2,1-C][1,4]BENZOXAZIN-7-AMINE, 2,3,3A,4-TETRAHYDRO- ; 2,3,3A,4-TETRAHYDRO-1H-PYRROLO[2,1-C][1,4]BENZOXAZIN-7-AMINE |
MDL Number.: | MFCD06656820 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1N)OCC3N2CCC3 |
InChi: | InChI=1S/C11H14N2O/c12-8-3-4-10-11(6-8)14-7-9-2-1-5-13(9)10/h3-4,6,9H,1-2,5,7,12H2 |
InChiKey: | InChIKey=FSXGCOVMYLFBLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.