* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-ISOCYANATO-1-METHYL-1H-INDOLE |
| CAS: | 887922-92-1 |
| English Synonyms: | 4-ISOCYANATO-1-METHYL-1H-INDOLE |
| MDL Number.: | MFCD08690262 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cn1ccc2c1cccc2N=C=O |
| InChi: | InChI=1S/C10H8N2O/c1-12-6-5-8-9(11-7-13)3-2-4-10(8)12/h2-6H,1H3 |
| InChiKey: | InChIKey=TVGVHXVLMROUII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.