* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XESTOSPONGIN C |
CAS: | 88903-69-9 |
English Synonyms: | XESTOSPONGIN C ; (-)-XESTOSPONGIN C ; XEC ; [1R-(1R,4AR,11R,12AS,13S,16AS,23R,24AS)]-EICOSAHYDRO-5H,17H-1,23:11,13-DIETHANO-2H,14H-[1,11]DIOXACYCLOEICOSINO[2,3-B:12,13-B1]DIPYRIDINE ; XESTOSPONGIN |
MDL Number.: | MFCD01862629 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C1CCC[C@H]2CCN3CCC[C@@H]([C@H]3O2)CCCCCC[C@H]4CCN5CCC[C@H]([C@H]5O4)CC1 |
InChi: | InChI=1S/C28H50N2O2/c1-3-7-15-25-17-21-30-20-10-14-24(28(30)31-25)12-6-2-4-8-16-26-18-22-29-19-9-13-23(11-5-1)27(29)32-26/h23-28H,1-22H2/t23-,24+,25-,26-,27+,28+/m0/s1 |
InChiKey: | InChIKey=PQYOPBRFUUEHRC-MUJQFDPKSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.