* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Ethanol, 2,2',2''-[1,3,5-triazine-2,4,6-triyltris(oxy)]tris- |
CAS: | 891-65-6 |
English Synonyms: | ETHANOL, 2,2',2''-[1,3,5-TRIAZINE-2,4,6-TRIYLTRIS(OXY)]TRIS- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1=C(N=C(N=C1OCCO)OCCO)OCCO |
InChi: | InChI=1S/C9H15N3O6/c13-1-4-16-7-10-8(17-5-2-14)12-9(11-7)18-6-3-15/h13-15H,1-6H2 |
InChiKey: | InChIKey=SQCQIDASMGZZPQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.