* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIOXADET |
| CAS: | 89286-76-0 ;67026-12-4 |
| English Synonyms: | DIOXADET |
| MDL Number.: | MFCD01730289 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CC1(OCC(CO1)(CO)Nc2nc(nc(n2)N3CC3)N4CC4)C |
| InChi: | InChI=1S/C14H22N6O3/c1-13(2)22-8-14(7-21,9-23-13)18-10-15-11(19-3-4-19)17-12(16-10)20-5-6-20/h21H,3-9H2,1-2H3,(H,15,16,17,18) |
| InChiKey: | InChIKey=QKBGEGKCGLXDSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.