* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(2,3,4,5,6-PENTAFLUOROPHENYL)-1H-INDOLE |
CAS: | 893734-39-9 |
English Synonyms: | 5-(2,3,4,5,6-PENTAFLUOROPHENYL)-1H-INDOLE ; 1H-INDOLE, 5-(2,3,4,5,6-PENTAFLUOROPHENYL)- |
MDL Number.: | MFCD06801987 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc2c(cc[nH]2)cc1c3c(c(c(c(c3F)F)F)F)F |
InChi: | InChI=1S/C14H6F5N/c15-10-9(11(16)13(18)14(19)12(10)17)7-1-2-8-6(5-7)3-4-20-8/h1-5,20H |
InChiKey: | InChIKey=MQHLLXFMAFRGIH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.