* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1,2,3,4-TETRAHYDROISOQUINOLIN-1-YL)-1-NAPHTHOL |
CAS: | 897035-09-5 |
English Synonyms: | 2-(1,2,3,4-TETRAHYDROISOQUINOLIN-1-YL)-1-NAPHTHOL |
MDL Number.: | MFCD09881436 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)ccc(c2O)C3c4ccccc4CCN3 |
InChi: | InChI=1S/C19H17NO/c21-19-16-8-4-2-5-13(16)9-10-17(19)18-15-7-3-1-6-14(15)11-12-20-18/h1-10,18,20-21H,11-12H2 |
InChiKey: | InChIKey=HDAWKBGPOULHDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.