* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-FLUORO-3-IODOPHENOL |
CAS: | 897956-98-8 |
English Synonyms: | 4-FLUORO-3-IODOPHENOL |
MDL Number.: | MFCD17000006 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1O)I)F |
InChi: | InChI=1S/C6H4FIO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
InChiKey: | InChIKey=QMDMLMOPLZBFTC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.