* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL 2-(3-METHYL-1,2,4-OXADIAZOL-5-YL)BENZOATE |
| CAS: | 898289-14-0 |
| English Synonyms: | METHYL 2-(3-METHYL-1,2,4-OXADIAZOL-5-YL)BENZOATE |
| MDL Number.: | MFCD08690280 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1nc(on1)c2ccccc2C(=O)OC |
| InChi: | InChI=1S/C11H10N2O3/c1-7-12-10(16-13-7)8-5-3-4-6-9(8)11(14)15-2/h3-6H,1-2H3 |
| InChiKey: | InChIKey=AMHURQVRFDDGPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.