* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(1,1-DIMETHYLETHYL)-2(3H)-BENZOTHIAZOLONE |
| CAS: | 898748-43-1 |
| English Synonyms: | 6-(1,1-DIMETHYLETHYL)-2(3H)-BENZOTHIAZOLONE |
| MDL Number.: | MFCD09746167 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)c1ccc2c(c1)sc(=O)[nH]2 |
| InChi: | InChI=1S/C11H13NOS/c1-11(2,3)7-4-5-8-9(6-7)14-10(13)12-8/h4-6H,1-3H3,(H,12,13) |
| InChiKey: | InChIKey=FYDKYMICZYHDMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.