* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE |
CAS: | 898785-43-8 |
English Synonyms: | 5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE |
MDL Number.: | MFCD03844222 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1(COC(OC1)CCCCC(=O)c2ccccc2)C |
InChi: | InChI=1S/C17H24O3/c1-17(2)12-19-16(20-13-17)11-7-6-10-15(18)14-8-4-3-5-9-14/h3-5,8-9,16H,6-7,10-13H2,1-2H3 |
InChiKey: | InChIKey=JOCQUPARSLWUJU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.