* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-IODOVALEROPHENONE |
CAS: | 898785-64-3 |
English Synonyms: | 5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-IODOVALEROPHENONE |
MDL Number.: | MFCD03844228 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1(COC(OC1)CCCCC(=O)c2ccc(cc2)I)C |
InChi: | InChI=1S/C17H23IO3/c1-17(2)11-20-16(21-12-17)6-4-3-5-15(19)13-7-9-14(18)10-8-13/h7-10,16H,3-6,11-12H2,1-2H3 |
InChiKey: | InChIKey=AGUCJKUAIWWONV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.