* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (2E)-1-(4-AMINOPHENYL)-3-(3-METHYLPHENYL)PROP-2-EN-1-ONE |
| CAS: | 899015-93-1 |
| English Synonyms: | (2E)-1-(4-AMINOPHENYL)-3-(3-METHYLPHENYL)PROP-2-EN-1-ONE |
| MDL Number.: | MFCD09559405 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1)/C=C/C(=O)c2ccc(cc2)N |
| InChi: | InChI=1S/C16H15NO/c1-12-3-2-4-13(11-12)5-10-16(18)14-6-8-15(17)9-7-14/h2-11H,17H2,1H3/b10-5+ |
| InChiKey: | InChIKey=NCWVAIXVAYKEKY-BJMVGYQFSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.