* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2E)-(R)-5-(Diphenylamino)-5-oxopent-3-en-2-yl 3-(5-nitrocyclohex-1-en-1-yl)acrylate |
CAS: | 900186-73-4 |
English Synonyms: | (2E)-(R)-5-(DIPHENYLAMINO)-5-OXOPENT-3-EN-2-YL 3-(5-NITROCYCLOHEX-1-EN-1-YL)ACRYLATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [N+](=O)([O-])C1CCC=C(C1)/C=C/C(=O)O[C@H](C)C=CC(=O)N(C1=CC=CC=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C26H26N2O5/c1-20(33-26(30)18-16-21-9-8-14-24(19-21)28(31)32)15-17-25(29)27(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,9-13,15-18,20,24H,8,14,19H2,1H3/b17-15?,18-16+/t20-,24?/m1/s1 |
InChiKey: | InChIKey=SIMVMXGCKDDNNL-QDSSTDSBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.