* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(3-OXOPROP-1-ENYL)ADENINE |
CAS: | 90029-73-5 |
English Synonyms: | 9-(3-OXOPROP-1-ENYL)ADENINE ; (2E)-3-(6-AMINO-9H-PURIN-9-YL)PROP-2-ENAL |
MDL Number.: | MFCD00272674 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1nc(c2c(n1)n(cn2)/C=C/C=O)N |
InChi: | InChI=1S/C8H7N5O/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-14/h1-5H,(H2,9,10,11)/b2-1+ |
InChiKey: | InChIKey=LYXOMQKQLZJTQN-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.