* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ACETAMIDOPHENOL-[RING-14C(U)] |
CAS: | 90135-67-4 |
English Synonyms: | 4-ACETAMIDOPHENOL-[RING-14C(U)] |
MDL Number.: | MFCD00055736 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(=O)N[14c]1[14cH][14cH][14c]([14cH][14cH]1)O |
InChi: | InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)/i2+2,3+2,4+2,5+2,7+2,8+2 |
InChiKey: | InChIKey=RZVAJINKPMORJF-ANARQPDSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.