* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2-ETHYL-PHENYL)-AZEPANE |
| CAS: | 901925-19-7 |
| English Synonyms: | 2-(2-ETHYL-PHENYL)-AZEPANE |
| MDL Number.: | MFCD05190486 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCc1ccccc1C2CCCCCN2 |
| InChi: | InChI=1S/C14H21N/c1-2-12-8-5-6-9-13(12)14-10-4-3-7-11-15-14/h5-6,8-9,14-15H,2-4,7,10-11H2,1H3 |
| InChiKey: | InChIKey=KMWLDFBBZNFIBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.