* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-1-OXA-4-AZASPIRO[4.4]NONANE |
| CAS: | 90204-33-4 |
| English Synonyms: | 2-METHYL-1-OXA-4-AZASPIRO[4.4]NONANE |
| MDL Number.: | MFCD05669699 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1CNC2(O1)CCCC2 |
| InChi: | InChI=1S/C8H15NO/c1-7-6-9-8(10-7)4-2-3-5-8/h7,9H,2-6H2,1H3 |
| InChiKey: | InChIKey=LUWNADIZRVWPEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.