* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AMINO-4,6-DIMETHYLBENZOIC ACID |
| CAS: | 90321-33-8 |
| English Synonyms: | 2-AMINO-4,6-DIMETHYLBENZOIC ACID |
| MDL Number.: | MFCD00130043 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(c(c1)N)C(=O)O)C |
| InChi: | InChI=1S/C9H11NO2/c1-5-3-6(2)8(9(11)12)7(10)4-5/h3-4H,10H2,1-2H3,(H,11,12) |
| InChiKey: | InChIKey=AQVKFJZUSUMLPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.