* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-METHYL-7-NITRO-1H-INDOLE-2,3-DIONE |
| CAS: | 90418-79-4 |
| English Synonyms: | 5-METHYL-7-NITRO-1H-INDOLE-2,3-DIONE |
| MDL Number.: | MFCD00030215 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1cc2c(c(c1)[N+](=O)[O-])NC(=O)C2=O |
| InChi: | InChI=1S/C9H6N2O4/c1-4-2-5-7(6(3-4)11(14)15)10-9(13)8(5)12/h2-3H,1H3,(H,10,12,13) |
| InChiKey: | InChIKey=NTRUHSPDGGDANP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.