* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,3-DICHLORO-8-METHOXY-1H-QUINOLINE-2,4-DIONE |
| CAS: | 90475-69-7 |
| English Synonyms: | 3,3-DICHLORO-8-METHOXY-1H-QUINOLINE-2,4-DIONE |
| MDL Number.: | MFCD04147423 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1cccc2c1NC(=O)C(C2=O)(Cl)Cl |
| InChi: | InChI=1S/C10H7Cl2NO3/c1-16-6-4-2-3-5-7(6)13-9(15)10(11,12)8(5)14/h2-4H,1H3,(H,13,15) |
| InChiKey: | InChIKey=QUECMMKDBHBZHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.