* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Acetamide, N-[(4-bromophenyl)methyl]- |
CAS: | 90561-76-5 |
English Synonyms: | ACETAMIDE, N-[(4-BROMOPHENYL)METHYL]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C(C=C1)CNC(C)=O |
InChi: | InChI=1S/C9H10BrNO/c1-7(12)11-6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3,(H,11,12) |
InChiKey: | InChIKey=HBBBWKUVJSIFKV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.