* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4,5-DIHYDRO-1,3-THIAZOL-2-YL)PHENOL |
| CAS: | 90563-68-1 |
| English Synonyms: | 4-(4,5-DIHYDRO-THIAZOL-2-YL)-PHENOL ; 4-(4,5-DIHYDRO-1,3-THIAZOL-2-YL)PHENOL |
| MDL Number.: | MFCD00085170 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1C2=NCCS2)O |
| InChi: | InChI=1S/C9H9NOS/c11-8-3-1-7(2-4-8)9-10-5-6-12-9/h1-4,11H,5-6H2 |
| InChiKey: | InChIKey=JDBUEZWQOCUAJT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.