* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(PYRROLIDIN-1-YL)PYRIDIN-3-AMINE |
CAS: | 90648-19-4 |
English Synonyms: | 4-(PYRROLIDIN-1-YL)PYRIDIN-3-AMINE |
MDL Number.: | MFCD10690637 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cncc(c1N2CCCC2)N |
InChi: | InChI=1S/C9H13N3/c10-8-7-11-4-3-9(8)12-5-1-2-6-12/h3-4,7H,1-2,5-6,10H2 |
InChiKey: | InChIKey=IXNZFEAFVPIIQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.