* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-AMINO-1,2,3,4-TETRAHYDRONAPHTHALEN-2-OL |
| CAS: | 90874-85-4 ;7480-36-6 |
| English Synonyms: | 1-AMINO-1,2,3,4-TETRAHYDRONAPHTHALEN-2-OL |
| MDL Number.: | MFCD10688387 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)CCC(C2N)O |
| InChi: | InChI=1S/C10H13NO/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-4,9-10,12H,5-6,11H2 |
| InChiKey: | InChIKey=NBUGQUVHXNWCTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.