* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FMOC-6-CHLORO-L-TRYPTOPHAN |
| CAS: | 908847-42-7 |
| English Synonyms: | FMOC-6-CHLORO-L-TRYPTOPHAN |
| MDL Number.: | MFCD16883068 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](Cc4c[nH]c5c4ccc(c5)Cl)C(=O)O |
| InChi: | InChI=1S/C26H21ClN2O4/c27-16-9-10-17-15(13-28-23(17)12-16)11-24(25(30)31)29-26(32)33-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-10,12-13,22,24,28H,11,14H2,(H,29,32)(H,30,31)/t24-/m0/s1 |
| InChiKey: | InChIKey=FDXGPPBWOOAVEL-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.