* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RONACTOLOL |
CAS: | 90895-85-5 |
English Synonyms: | RONACTOLOL |
MDL Number.: | MFCD00868805 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC(C)NCC(COc1ccc(cc1)NC(=O)c2ccc(cc2)OC)O |
InChi: | InChI=1S/C20H26N2O4/c1-14(2)21-12-17(23)13-26-19-10-6-16(7-11-19)22-20(24)15-4-8-18(25-3)9-5-15/h4-11,14,17,21,23H,12-13H2,1-3H3,(H,22,24) |
InChiKey: | InChIKey=BPNZFFWEUGGXMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.