* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4-METHYL-1-PIPERAZINYL)-BENZAMIDE |
| CAS: | 909253-26-5 |
| English Synonyms: | 4-(4-METHYL-1-PIPERAZINYL)-BENZAMIDE |
| MDL Number.: | MFCD16990502 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN1CCN(CC1)c2ccc(cc2)C(=O)N |
| InChi: | InChI=1S/C12H17N3O/c1-14-6-8-15(9-7-14)11-4-2-10(3-5-11)12(13)16/h2-5H,6-9H2,1H3,(H2,13,16) |
| InChiKey: | InChIKey=YUVVFVSCHNTYIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.