* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-BROMO-2-IODONAPHTHALENE |
| CAS: | 90948-03-1 |
| English Synonyms: | 1-BROMO-2-IODONAPHTHALENE |
| MDL Number.: | MFCD17012424 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)ccc(c2Br)I |
| InChi: | InChI=1S/C10H6BrI/c11-10-8-4-2-1-3-7(8)5-6-9(10)12/h1-6H |
| InChiKey: | InChIKey=JUMJPYBBRSXJBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.