* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROBUTAMINE |
| CAS: | 91-82-7 |
| English Synonyms: | PYRROBUTAMINE |
| MDL Number.: | MFCD00865667 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)/C(=C\CN2CCCC2)/Cc3ccc(cc3)Cl |
| InChi: | InChI=1S/C20H22ClN/c21-20-10-8-17(9-11-20)16-19(18-6-2-1-3-7-18)12-15-22-13-4-5-14-22/h1-3,6-12H,4-5,13-16H2/b19-12- |
| InChiKey: | InChIKey=WDYYVNNRTDZKAZ-UNOMPAQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.