* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINCRISTINE M1 |
| CAS: | 910580-56-2 |
| English Synonyms: | VINCRISTINE M1 |
| MDL Number.: | MFCD21608757 |
| H bond acceptor: | 14 |
| H bond donor: | 3 |
| Smile: | CCC(=O)C[C@@H]1C[C@@](c2c(c3ccccc3[nH]2)CCNC1)(c4cc5c(cc4OC)N([C@@H]6[C@]57CCN8[C@H]7[C@@](C=CC8)([C@H]([C@@]6(C(=O)OC)O)OC(=O)C)CC)C=O)C(=O)OC |
| InChi: | InChI=1S/C45H54N4O10/c1-7-28(52)20-27-23-44(40(53)57-5,36-30(14-17-46-24-27)29-12-9-10-13-33(29)47-36)32-21-31-34(22-35(32)56-4)49(25-50)38-43(31)16-19-48-18-11-15-42(8-2,37(43)48)39(59-26(3)51)45(38,55)41(54)58-6/h9-13,15,21-22,25,27,37-39,46-47,55H,7-8,14,16-20,23-24H2,1-6H3/t27-,37+,38-,39-,42-,43-,44+,45+/m1/s1 |
| InChiKey: | InChIKey=GHCGXAFOOQYBDC-QPSORRKESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.