* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | O-Phenyl-D-tyrosine |
CAS: | 911457-76-6 |
English Synonyms: | O-PHENYL-D-TYROSINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)OC1=CC=C(C[C@@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C15H15NO3/c16-14(15(17)18)10-11-6-8-13(9-7-11)19-12-4-2-1-3-5-12/h1-9,14H,10,16H2,(H,17,18)/t14-/m1/s1 |
InChiKey: | InChIKey=DRDNRDDAAFSVNM-CQSZACIVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.