* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KARAVILAGENIN A |
| CAS: | 912329-03-4 |
| English Synonyms: | KARAVILAGENIN A |
| MDL Number.: | MFCD20260935 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@H](C/C=C/C(C)(C)OC)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)OC)C)C)C |
| InChi: | InChI=1S/C32H54O3/c1-21(12-11-16-28(2,3)35-10)22-15-17-32(8)27-25(34-9)20-24-23(13-14-26(33)29(24,4)5)30(27,6)18-19-31(22,32)7/h11,16,20-23,25-27,33H,12-15,17-19H2,1-10H3/b16-11+/t21-,22-,23-,25+,26+,27-,30+,31-,32+/m1/s1 |
| InChiKey: | InChIKey=OJXKMMLNVLFMJM-QTACYZFBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.