* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Boc-N-ethyl-L-alanine |
CAS: | 91292-56-7 |
English Synonyms: | N-BOC-N-ETHYL-L-ALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N([C@@H](C)C(=O)O)CC |
InChi: | InChI=1S/C10H19NO4/c1-6-11(7(2)8(12)13)9(14)15-10(3,4)5/h7H,6H2,1-5H3,(H,12,13)/t7-/m0/s1 |
InChiKey: | InChIKey=GFJATYWLXLZSCZ-ZETCQYMHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.